Online Database of Chemicals from Around the World
|
CAS#: 6366-20-7 Product: 7-Methoxybenz[a]Anthracene No suppilers available for the product. |
| Name | 7-Methoxybenz[a]Anthracene |
|---|---|
| Synonyms | 10-Methoxy-1,2-Benzanthracene; 3-06-00-03727 (Beilstein Handbook Reference); 7-Methoxybenz(A)Anthracene |
| Molecular Structure | ![CAS#: 6366-20-7， 7-Methoxybenz[a]Anthracene](/moreStructures/6366-20-7.gif) |
| Molecular Formula | C19H14O |
| Molecular Weight | 258.32 |
| CAS Registry Number | 6366-20-7 |
| SMILES | C1=C3C(=C(C2=CC=CC=C12)OC)C=CC4=C3C=CC=C4 |
| InChI | 1S/C19H14O/c1-20-19-16-9-5-3-7-14(16)12-18-15-8-4-2-6-13(15)10-11-17(18)19/h2-12H,1H3 |
| InChIKey | HJZXAMRDNRIFQW-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.27°C at 760 mmHg (Cal.) |
| Flash point | 193.148°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methoxybenz[a]Anthracene |