Online Database of Chemicals from Around the World
|
CAS#: 949-02-0 Product: 4-Methoxybenzamide O-acetyloxime No suppilers available for the product. |
| Name | 4-Methoxybenzamide O-acetyloxime |
|---|---|
| Synonyms | [[Amino-(4-Methoxyphenyl)Methylene]Amino] Acetate; Acetic Acid [[Amino-(4-Methoxyphenyl)Methylene]Amino] Ester; [[Amino-(4-Methoxyphenyl)Methylidene]Amino] Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 |
| CAS Registry Number | 949-02-0 |
| SMILES | C1=C(\C(=N/OC(=O)C)N)C=CC(=C1)OC |
| InChI | 1S/C10H12N2O3/c1-7(13)15-12-10(11)8-3-5-9(14-2)6-4-8/h3-6H,1-2H3,(H2,11,12) |
| InChIKey | ULTOOQAMLJIAOF-UHFFFAOYSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.707°C at 760 mmHg (Cal.) |
| Flash point | 156.225°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methoxybenzamide O-acetyloxime |