|
CAS#: 63991-26-4 Product: Ephedrine Hydrochloride No suppilers available for the product. |
| Name | Ephedrine Hydrochloride |
|---|---|
| Synonyms | (2-Hydroxy-1-Methyl-2-Phenyl-Ethyl)-Methyl-Ammonium Chloride; (2-Hydroxy-1-Methyl-2-Phenylethyl)-Methylammonium Chloride; (1-Hydroxy-1-Phenyl-Propan-2-Yl)-Methyl-Azanium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 |
| CAS Registry Number | 63991-26-4 |
| SMILES | C1=C(C(O)C([NH2+]C)C)C=CC=C1.[Cl-] |
| InChI | 1S/C10H15NO.ClH/c1-8(11-2)10(12)9-6-4-3-5-7-9;/h3-8,10-12H,1-2H3;1H |
| InChIKey | BALXUFOVQVENIU-UHFFFAOYSA-N |
| Boiling point | 255°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 85.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ephedrine Hydrochloride |