Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,1'-[(Z)-1,2-Difluoro-1,2-Ethenediyl]Dibenzene |
|---|---|
| Synonyms | Benzene,1,1'-(1,2-difluoro-1,2-ethenediyl)bis- (9CI) |
| Molecular Structure | ![CAS#: 643-76-5， 1,1'-[(Z)-1,2-Difluoro-1,2-Ethenediyl]Dibenzene](/moreStructures/643-76-5.gif) |
| Molecular Formula | C14H10F2 |
| Molecular Weight | 216.23 |
| CAS Registry Number | 643-76-5 |
| SMILES | F/C(=C(\F)c1ccccc1)c2ccccc2 |
| InChI | 1S/C14H10F2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H/b14-13- |
| InChIKey | VIWUJKBBJRFTMC-YPKPFQOOSA-N |
| Density | 1.137g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.708°C at 760 mmHg (Cal.) |
| Flash point | 106.214°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[(Z)-1,2-Difluoro-1,2-Ethenediyl]Dibenzene |