|
CAS#: 85074-88-0 Product: 1,1'-[(E)-1,2-Difluoro-1,2-ethenediyl]bis(4-methoxybenzene) No suppilers available for the product. |
| Name | 1,1'-[(E)-1,2-Difluoro-1,2-ethenediyl]bis(4-methoxybenzene) |
|---|---|
| Synonyms | 1,1'-[(1E)-1,2-Difluoro-1,2-ethenediyl]bis[4-methoxybenzene] |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14F2O2 |
| Molecular Weight | 276.28 |
| CAS Registry Number | 85074-88-0 |
| SMILES | COC1=CC=C(C=C1)/C(=C(/C2=CC=C(C=C2)OC)\F)/F |
| InChI | 1S/C16H14F2O2/c1-19-13-7-3-11(4-8-13)15(17)16(18)12-5-9-14(20-2)10-6-12/h3-10H,1-2H3/b16-15+ |
| InChIKey | MUFHCTBBUXEICJ-FOCLMDBBSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.6±42.0°C at 760 mmHg (Cal.) |
| Flash point | 198.7±23.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[(E)-1,2-Difluoro-1,2-ethenediyl]bis(4-methoxybenzene) |