Online Database of Chemicals from Around the World
|
CAS#: 936250-23-6 Product: [3-(2,2-Difluoroethoxy)-4,5-difluorophenyl]boronic acid No suppilers available for the product. |
| Name | [3-(2,2-Difluoroethoxy)-4,5-difluorophenyl]boronic acid |
|---|---|
| Synonyms | 3-(2,2-Difluoro-ethoxy)-4,5-difluoro-benzeneboronic acid |
| Molecular Structure | ![CAS#: 936250-23-6， [3-(2,2-Difluoroethoxy)-4,5-difluorophenyl]boronic acid](/moreStructures/936250-23-6.gif) |
| Molecular Formula | C8H7BF4O3 |
| Molecular Weight | 237.94 |
| CAS Registry Number | 936250-23-6 |
| SMILES | OB(O)c1cc(OCC(F)F)c(F)c(F)c1 |
| InChI | 1S/C8H7BF4O3/c10-5-1-4(9(14)15)2-6(8(5)13)16-3-7(11)12/h1-2,7,14-15H,3H2 |
| InChIKey | YOWBSHPKPTTYFK-UHFFFAOYSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.751°C at 760 mmHg (Cal.) |
| Flash point | 153.833°C (Cal.) |
| Refractive index | 1.45 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [3-(2,2-Difluoroethoxy)-4,5-difluorophenyl]boronic acid |