|
CAS#: 6793-24-4 Product: Buphanamine No suppilers available for the product. |
| Name | Buphanamine |
|---|---|
| Synonyms | Buphanamine, 2-; Buphanamin; Buphanamine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 |
| CAS Registry Number | 6793-24-4 |
| SMILES | [C@@H]5([C@]34C2=CC1=C(OCO1)C(=C2CN(CC3)[C@@H]4CC=C5)OC)O |
| InChI | 1S/C17H19NO4/c1-20-15-10-8-18-6-5-17(13(18)3-2-4-14(17)19)11(10)7-12-16(15)22-9-21-12/h2,4,7,13-14,19H,3,5-6,8-9H2,1H3/t13-,14-,17+/m1/s1 |
| InChIKey | XJJVWAWKCIATTE-CPUCHLNUSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.9±45.0°C at 760 mmHg (Cal.) |
| Flash point | 245.9±28.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Buphanamine |