| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| VDM Biochemicals | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (330) 252-8181/ | |||
![]() |
sales@vdmbio.com,info@vdmbio.com | |||
| Chemical manufacturer | ||||
| Name | (1R,2S,5R)-2-Isopropyl-N-(4-methoxyphenyl)-5-methylcyclohexanecarboxamide |
|---|---|
| Synonyms | WS 12 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.41 |
| CAS Registry Number | 68489-09-8 |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)C(=O)NC2=CC=C(C=C2)OC)C(C)C |
| InChI | 1S/C18H27NO2/c1-12(2)16-10-5-13(3)11-17(16)18(20)19-14-6-8-15(21-4)9-7-14/h6-9,12-13,16-17H,5,10-11H2,1-4H3,(H,19,20)/t13-,16+,17-/m1/s1 |
| InChIKey | HNSGVPAAXJJOPQ-XOKHGSTOSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.8±28.0°C at 760 mmHg (Cal.) |
| Flash point | 224.6±24.0°C (Cal.) |
| solubility | Soluble to 75 mM in ethanol |
| Market Analysis Reports |
| List of Reports Available for (1R,2S,5R)-2-Isopropyl-N-(4-methoxyphenyl)-5-methylcyclohexanecarboxamide |