|
CAS#: 87105-10-0 Product: 12-Isopropyl-9-[4-(4-methoxyphenyl)butyl]-3-methyl-6-methylene-1-oxa-4,7,10-triazacyclododecane-2,5,8,11-tetrone No suppilers available for the product. |
| Name | 12-Isopropyl-9-[4-(4-methoxyphenyl)butyl]-3-methyl-6-methylene-1-oxa-4,7,10-triazacyclododecane-2,5,8,11-tetrone |
|---|---|
| Synonyms | (2-Amino-6-(4-methoxyphenyl)hexanoic acid)-AM toxin I; AM Toxin I, (2-amino-6-(4-methoxyphenyl)hexanoic acid)-; Ampha-AM toxin I |
| Molecular Structure | ![]() |
| Molecular Formula | C24H33N3O6 |
| Molecular Weight | 459.54 |
| CAS Registry Number | 87105-10-0 |
| SMILES | O=C1NC(C(=O)N/C(C(=O)NC(C(=O)OC1C(C)C)C)=C)CCCCc2ccc(OC)cc2 |
| InChI | 1S/C24H33N3O6/c1-14(2)20-23(30)27-19(9-7-6-8-17-10-12-18(32-5)13-11-17)22(29)25-15(3)21(28)26-16(4)24(31)33-20/h10-14,16,19-20H,3,6-9H2,1-2,4-5H3,(H,25,29)(H,26,28)(H,27,30) |
| InChIKey | HIZFOBQMHOLKJR-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 809.238°C at 760 mmHg (Cal.) |
| Flash point | 443.211°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 12-Isopropyl-9-[4-(4-methoxyphenyl)butyl]-3-methyl-6-methylene-1-oxa-4,7,10-triazacyclododecane-2,5,8,11-tetrone |