|
CAS#: 87105-09-7 Product: 12-Isopropyl-9-[2-(4-methoxyphenyl)ethyl]-3-methyl-6-methylene-1-oxa-4,7,10-triazacyclododecane-2,5,8,11-tetrone No suppilers available for the product. |
| Name | 12-Isopropyl-9-[2-(4-methoxyphenyl)ethyl]-3-methyl-6-methylene-1-oxa-4,7,10-triazacyclododecane-2,5,8,11-tetrone |
|---|---|
| Synonyms | (2-Amino-4-(4-methoxyphenyl)butanoic acid)-AM toxin I; AM Toxin I, (2-amino-4-(4-methoxyphenyl)butanoic acid)-; AM Toxin I, ampba- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H29N3O6 |
| Molecular Weight | 431.48 |
| CAS Registry Number | 87105-09-7 |
| SMILES | O=C1NC(C(=O)N/C(C(=O)NC(C(=O)OC1C(C)C)C)=C)CCc2ccc(OC)cc2 |
| InChI | 1S/C22H29N3O6/c1-12(2)18-21(28)25-17(11-8-15-6-9-16(30-5)10-7-15)20(27)23-13(3)19(26)24-14(4)22(29)31-18/h6-7,9-10,12,14,17-18H,3,8,11H2,1-2,4-5H3,(H,23,27)(H,24,26)(H,25,28) |
| InChIKey | YSONUVGWOCXRPA-UHFFFAOYSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 806.946°C at 760 mmHg (Cal.) |
| Flash point | 441.825°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 12-Isopropyl-9-[2-(4-methoxyphenyl)ethyl]-3-methyl-6-methylene-1-oxa-4,7,10-triazacyclododecane-2,5,8,11-tetrone |