Online Database of Chemicals from Around the World
|
CAS#: 70648-21-4 Product: 1,3,6,7,8-Pentachlorodibenzofuran No suppilers available for the product. |
| Name | 1,3,6,7,8-Pentachlorodibenzofuran |
|---|---|
| Synonyms | 2,3,4,7,9-Pentachlorodibenzofuran; Dibenzofuran, 2,3,4,7,9-Pentachloro; Dibenzofuran, 1,3,6,7,8-Pentachloro- |
| Molecular Structure |  |
| Molecular Formula | C12H3Cl5O |
| Molecular Weight | 340.42 |
| CAS Registry Number | 70648-21-4 |
| SMILES | C1=C(C=C3C(=C1Cl)C2=C(C(=C(C(=C2)Cl)Cl)Cl)O3)Cl |
| InChI | 1S/C12H3Cl5O/c13-4-1-6(14)9-5-3-7(15)10(16)11(17)12(5)18-8(9)2-4/h1-3H |
| InChIKey | FRLMQDUYUJIHCZ-UHFFFAOYSA-N |
| Density | 1.7g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.225°C at 760 mmHg (Cal.) |
| Flash point | 224.879°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,6,7,8-Pentachlorodibenzofuran |