| AccuStandard Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,2,3,7,8-Pentachlorodibenzofuran |
|---|---|
| Synonyms | 1,2,3,7,8-Pentachlorodibenzofuran [Dioxin And Dioxin-Like Compounds]; Dibenzofuran, 1,2,3,7,8-Pentachloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H3Cl5O |
| Molecular Weight | 340.42 |
| CAS Registry Number | 57117-41-6 |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)OC3=C2C(=C(C(=C3)Cl)Cl)Cl |
| InChI | 1S/C12H3Cl5O/c13-5-1-4-8(2-6(5)14)18-9-3-7(15)11(16)12(17)10(4)9/h1-3H |
| InChIKey | SBMIVUVRFPGOEB-UHFFFAOYSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.6±40.0°C at 760 mmHg (Cal.) |
| Flash point | 226.3±27.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,7,8-Pentachlorodibenzofuran |