| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Organic raw materials >> Organic phosphine compound |
|---|---|
| Name | Di-n-Pentylphenylphosphine |
| Synonyms | Dipentyl-Phenyl-Phosphane; Diamyl-Phenyl-Phosphane; St5407033 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H27P |
| Molecular Weight | 250.36 |
| CAS Registry Number | 71501-08-1 |
| EINECS | 275-541-0 |
| SMILES | C1=C(P(CCCCC)CCCCC)C=CC=C1 |
| InChI | 1S/C16H27P/c1-3-5-10-14-17(15-11-6-4-2)16-12-8-7-9-13-16/h7-9,12-13H,3-6,10-11,14-15H2,1-2H3 |
| InChIKey | QDZAKCWPRPKCBW-UHFFFAOYSA-N |
| Boiling point | 209-211°C (Expl.) |
|---|---|
| 339.0±11.0°C at 760 mmHg (Cal.) | |
| Flash point | 166.5±25.6°C (Cal.) |
| Safety Code | S26;S36/37 Details |
|---|---|
| Risk Code | R22;R36/38 Details |
| Hazard Symbol | X Details |
| Safety Description | DANGER: POISON, irritates skin, eyes, lungs |
| WARNING: Irritates skin and eyes, harmful if swallowed | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Di-n-Pentylphenylphosphine |