|
CAS#: 7252-91-7 Product: 5-beta-Pregnan-3alpha,11beta,17-Triol-20-One No suppilers available for the product. |
| Name | 5-beta-Pregnan-3alpha,11beta,17-Triol-20-One |
|---|---|
| Synonyms | Nsc53891; C15403; Tetrahydro-21-Deoxycortisol |
| Molecular Structure | ![]() |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 |
| CAS Registry Number | 7252-91-7 |
| SMILES | [C@]1([C@]2(C)[C@@H](CC1)[C@H]4[C@H]([C@@H](O)C2)[C@]3(CC[C@@H](O)C[C@H]3CC4)C)(O)C(C)=O |
| InChI | 1S/C21H34O4/c1-12(22)21(25)9-7-16-15-5-4-13-10-14(23)6-8-19(13,2)18(15)17(24)11-20(16,21)3/h13-18,23-25H,4-11H2,1-3H3/t13-,14-,15+,16+,17+,18-,19+,20+,21+/m1/s1 |
| InChIKey | VHYUGQIWISVBRT-SUTVCERISA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.564°C at 760 mmHg (Cal.) |
| Flash point | 273.042°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-beta-Pregnan-3alpha,11beta,17-Triol-20-One |