Online Database of Chemicals from Around the World
|
CAS#: 99207-79-1 Product: 5-Pregnen-3,20-Diol Glucoside No suppilers available for the product. |
| Name | 5-Pregnen-3,20-Diol Glucoside |
|---|---|
| Synonyms | 2-[1-(3-Hydroxy-10,13-Dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-17-Yl)Ethoxy]-6-(Hydroxymethyl)Tetrahydropyran-3,4,5-Triol; 2-[1-(3-Hydroxy-10,13-Dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenan |
| Molecular Structure |  |
| Molecular Formula | C27H44O7 |
| Molecular Weight | 480.64 |
| CAS Registry Number | 99207-79-1 |
| SMILES | C(O)C5OC(OC(C4C3(C(C1C(C2(C(=CC1)CC(O)CC2)C)CC3)CC4)C)C)C(O)C(O)C5O |
| InChI | 1S/C27H44O7/c1-14(33-25-24(32)23(31)22(30)21(13-28)34-25)18-6-7-19-17-5-4-15-12-16(29)8-10-26(15,2)20(17)9-11-27(18,19)3/h4,14,16-25,28-32H,5-13H2,1-3H3 |
| InChIKey | ZSJWDKSRQKSIBU-UHFFFAOYSA-N |
| Density | 1.278g/cm3 (Cal.) |
|---|---|
| Boiling point | 647.12°C at 760 mmHg (Cal.) |
| Flash point | 345.166°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Pregnen-3,20-Diol Glucoside |