Online Database of Chemicals from Around the World
|
CAS#: 7428-83-3 Product: 6-Aminobenzo(a)Pyrene No suppilers available for the product. |
| Name | 6-Aminobenzo(a)Pyrene |
|---|---|
| Synonyms | 6-Benzo[B]Pyrenamine; Benzo[B]Pyren-6-Ylamine; 3-12-00-03404 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C20H13N |
| Molecular Weight | 267.33 |
| CAS Registry Number | 7428-83-3 |
| SMILES | C1=CC4=C3C2=C1C5=C(C(=C2C=CC3=CC=C4)N)C=CC=C5 |
| InChI | 1S/C20H13N/c21-20-16-7-2-1-6-14(16)15-10-8-12-4-3-5-13-9-11-17(20)19(15)18(12)13/h1-11H,21H2 |
| InChIKey | CZURZERLMHKKGV-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.627°C at 760 mmHg (Cal.) |
| Flash point | 301.964°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Aminobenzo(a)Pyrene |