Online Database of Chemicals from Around the World
|
CAS#: 82507-21-9 Product: 4-Aminobenzo[a]Pyrene No suppilers available for the product. |
| Name | 4-Aminobenzo[a]Pyrene |
|---|---|
| Synonyms | 4-Benzo[I]Pyrenamine; Benzo[I]Pyren-4-Ylamine; 4-Aminobenzo(A)Pyrene |
| Molecular Structure | ![CAS#: 82507-21-9， 4-Aminobenzo[a]Pyrene](/moreStructures/82507-21-9.gif) |
| Molecular Formula | C20H13N |
| Molecular Weight | 267.33 |
| CAS Registry Number | 82507-21-9 |
| SMILES | C1=CC=CC2=C1C=C5C3=C4C(=CC=C23)C=CC=C4C(=C5)N |
| InChI | 1S/C20H13N/c21-18-11-14-10-13-4-1-2-6-15(13)16-9-8-12-5-3-7-17(18)19(12)20(14)16/h1-11H,21H2 |
| InChIKey | BJHPDTFXCVOKGZ-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 529.994°C at 760 mmHg (Cal.) |
| Flash point | 306.047°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Aminobenzo[a]Pyrene |