Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (2,3,4-Trihydroxybenzyl)malononitrile |
|---|---|
| Synonyms | 2-(2,3,4-trihydroxybenzyl)malononitrile |
| Molecular Structure |  |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18 |
| CAS Registry Number | 771559-06-9 |
| SMILES | c1cc(c(c(c1CC(C#N)C#N)O)O)O |
| InChI | 1S/C10H8N2O3/c11-4-6(5-12)3-7-1-2-8(13)10(15)9(7)14/h1-2,6,13-15H,3H2 |
| InChIKey | RYOGTBFZHXKVDG-UHFFFAOYSA-N |
| Density | 1.483g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.231°C at 760 mmHg (Cal.) |
| Flash point | 282.336°C (Cal.) |
| Refractive index | 1.655 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,3,4-Trihydroxybenzyl)malononitrile |