Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,2',3-Trihydroxybiphenyl |
|---|---|
| Synonyms | 3-(2-Hydroxyphenyl)Pyrocatechol; Biphenyl-2,2',3-Triol; 2,2',3-Trihydroxybiphenyl |
| Molecular Structure |  |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 91368-55-7 |
| SMILES | C2=C(C1=CC=CC=C1O)C(=C(O)C=C2)O |
| InChI | 1S/C12H10O3/c13-10-6-2-1-4-8(10)9-5-3-7-11(14)12(9)15/h1-7,13-15H |
| InChIKey | USBNIYMZDQVDSO-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.822°C at 760 mmHg (Cal.) |
| Flash point | 194.226°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2',3-Trihydroxybiphenyl |