Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (2,4,5-Trihydroxybenzylidene)malononitrile |
|---|---|
| Synonyms | 2-(2,4,5-trihydroxybenzylidene)malononitrile |
| Molecular Structure |  |
| Molecular Formula | C10H6N2O3 |
| Molecular Weight | 202.17 |
| CAS Registry Number | 771575-34-9 |
| SMILES | c1c(c(cc(c1O)O)O)C=C(C#N)C#N |
| InChI | 1S/C10H6N2O3/c11-4-6(5-12)1-7-2-9(14)10(15)3-8(7)13/h1-3,13-15H |
| InChIKey | FQXQPDTZQLCEKN-UHFFFAOYSA-N |
| Density | 1.57g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.807°C at 760 mmHg (Cal.) |
| Flash point | 268.775°C (Cal.) |
| Refractive index | 1.743 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,4,5-Trihydroxybenzylidene)malononitrile |