Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,3-Dihydro-2-Thioxo-1H-Benzimidazole-4-Carboxamide |
|---|---|
| Synonyms | 1H-Benzimidazole-4-Carboxamide,2,3-Dihydro-2-Thioxo- |
| Molecular Structure |  |
| Molecular Formula | C8H7N3OS |
| Molecular Weight | 193.23 |
| CAS Registry Number | 791591-51-0 |
| SMILES | NC(=O)c1cccc2c1[nH]c(=S)[nH]2 |
| InChI | 1S/C8H7N3OS/c9-7(12)4-2-1-3-5-6(4)11-8(13)10-5/h1-3H,(H2,9,12)(H2,10,11,13) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-2-Thioxo-1H-Benzimidazole-4-Carboxamide |