Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 6-(3,6-Dihydro-2H-thiopyran-4-yl)-1H-indazole |
|---|---|
| Synonyms | 1H-Indazole, 6-(3,6-dihydro-2H-thiopyran-4-yl)-; 1H-INDAZOLE,6-(3,6-DIHYDRO-2H-THIOPYRAN-4-YL)-; 6-(3,6-Dihydro-2H-thiopyran-4-yl)-1H-indazol |
| Molecular Structure |  |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.30 |
| CAS Registry Number | 885272-24-2 |
| SMILES | c1cc2cn[nH]c2cc1C3=CCSCC3 |
| InChI | 1S/C12H12N2S/c1-2-11-8-13-14-12(11)7-10(1)9-3-5-15-6-4-9/h1-3,7-8H,4-6H2,(H,13,14) |
| InChIKey | XFTAWMONOKNQNM-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.6±45.0°C at 760 mmHg (Cal.) |
| Flash point | 218.5±28.7°C (Cal.) |
| Refractive index | 1.715 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(3,6-Dihydro-2H-thiopyran-4-yl)-1H-indazole |