|
CAS#: 885273-29-0 Product: 5-(3,6-Dihydro-2H-thiopyran-4-yl)-1H-indole No suppilers available for the product. |
| Name | 5-(3,6-Dihydro-2H-thiopyran-4-yl)-1H-indole |
|---|---|
| Synonyms | 1H-Indole, 5-(3,6-dihydro-2H-thiopyran-4-yl)-; 1H-INDOLE,5-(3,6-DIHYDRO-2H-THIOPYRAN-4-YL)-; 5-(3,6-Dihydro-2H-thiopyran-4-yl)-1H-indol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.31 |
| CAS Registry Number | 885273-29-0 |
| SMILES | c1cc2c(cc[nH]2)cc1C3=CCSCC3 |
| InChI | 1S/C13H13NS/c1-2-13-12(3-6-14-13)9-11(1)10-4-7-15-8-5-10/h1-4,6,9,14H,5,7-8H2 |
| InChIKey | BZRVGHIPXRVDIP-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.0±45.0°C at 760 mmHg (Cal.) |
| Flash point | 210.8±28.7°C (Cal.) |
| Refractive index | 1.705 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(3,6-Dihydro-2H-thiopyran-4-yl)-1H-indole |