Online Database of Chemicals from Around the World
|
CAS#: 82291-35-8 Product: 1,2,4,6,7-Pentachlorodibenzo[1,4]Dioxin No suppilers available for the product. |
| Name | 1,2,4,6,7-Pentachlorodibenzo[1,4]Dioxin |
|---|---|
| Synonyms | Dibenzo-P-Dioxin, 1,2,4,6,7-Pentachloro; 1,2,4,6,7-Pentachlorodibenzodioxin; 1,2,4,6,7-Pentachlorodibenzo-P-Dioxin |
| Molecular Structure | ![CAS#: 82291-35-8， 1,2,4,6,7-Pentachlorodibenzo[1,4]Dioxin](/moreStructures/82291-35-8.gif) |
| Molecular Formula | C12H3Cl5O2 |
| Molecular Weight | 356.42 |
| CAS Registry Number | 82291-35-8 |
| SMILES | C1=C(C(=C3C(=C1Cl)OC2=C(C(=CC=C2O3)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H3Cl5O2/c13-4-1-2-7-11(8(4)16)19-10-6(15)3-5(14)9(17)12(10)18-7/h1-3H |
| InChIKey | SEKDDGLKEYEVQK-UHFFFAOYSA-N |
| Density | 1.714g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.728°C at 760 mmHg (Cal.) |
| Flash point | 171.621°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4,6,7-Pentachlorodibenzo[1,4]Dioxin |