Online Database of Chemicals from Around the World
| AccuStandard Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (203) 786-5290 | |||
 |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,7,8-Trichlorodibenzo-P-Dioxin |
|---|---|
| Synonyms | Dibenzo-P-Dioxin, 1,7,8-Trichloro; 1,7,8-Trichlorodibenzo(B,E)(1,4)Dioxin; Dibenzo(B,E)(1,4)Dioxin, 1,7,8-Trichloro- |
| Molecular Structure |  |
| Molecular Formula | C12H5Cl3O2 |
| Molecular Weight | 287.53 |
| CAS Registry Number | 82306-65-8 |
| SMILES | C3=C2OC1=CC(=C(C=C1OC2=C(C=C3)Cl)Cl)Cl |
| InChI | 1S/C12H5Cl3O2/c13-6-2-1-3-9-12(6)17-11-5-8(15)7(14)4-10(11)16-9/h1-5H |
| InChIKey | GXPWNYXJJDQHBO-UHFFFAOYSA-N |
| Density | 1.563g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.576°C at 760 mmHg (Cal.) |
| Flash point | 152.678°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,7,8-Trichlorodibenzo-P-Dioxin |