Online Database of Chemicals from Around the World
| Name | 2,4,6-Trichlorodibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, 2,4,6-Trichloro-; Dibenzofuran, 2,4,6-Trichloro |
| Molecular Structure |  |
| Molecular Formula | C12H5Cl3O |
| Molecular Weight | 271.53 |
| CAS Registry Number | 58802-14-5 |
| SMILES | C1=C2C(=C(C=C1)Cl)OC3=C2C=C(C=C3Cl)Cl |
| InChI | 1S/C12H5Cl3O/c13-6-4-8-7-2-1-3-9(14)11(7)16-12(8)10(15)5-6/h1-5H |
| InChIKey | GTKURBTWZFQHHY-UHFFFAOYSA-N |
| Density | 1.54g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.114°C at 760 mmHg (Cal.) |
| Flash point | 187.92°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Trichlorodibenzofuran |
