Online Database of Chemicals from Around the World
|
CAS#: 43048-00-6 Product: Trichlorodibenzofuran No suppilers available for the product. |
| Name | Trichlorodibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, Trichloro-; Trichlorodibenzofuran; Dibenzofuran, 1,3,4-Trichloro |
| Molecular Structure |  |
| Molecular Formula | C12H5Cl3O |
| Molecular Weight | 271.53 |
| CAS Registry Number | 43048-00-6 |
| SMILES | C1=C2C(=CC=C1)OC3=C2C(=CC(=C3Cl)Cl)Cl |
| InChI | 1S/C12H5Cl3O/c13-7-5-8(14)11(15)12-10(7)6-3-1-2-4-9(6)16-12/h1-5H |
| InChIKey | FIPOITUDJFQRRN-UHFFFAOYSA-N |
| Density | 1.54g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.901°C at 760 mmHg (Cal.) |
| Flash point | 186.582°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichlorodibenzofuran |