|
CAS#: 908333-93-7 Product: 2-(3-Bromophenyl)-4-methyl-2,5-dihydro-1,2,3-thiadiazole 1,1-dioxide No suppilers available for the product. |
| Name | 2-(3-Bromophenyl)-4-methyl-2,5-dihydro-1,2,3-thiadiazole 1,1-dioxide |
|---|---|
| Synonyms | 2-(3-Brom |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9BrN2O2S |
| Molecular Weight | 289.15 |
| CAS Registry Number | 908333-93-7 |
| SMILES | CC1=NN(S(=O)(=O)C1)c2cccc(c2)Br |
| InChI | 1S/C9H9BrN2O2S/c1-7-6-15(13,14)12(11-7)9-4-2-3-8(10)5-9/h2-5H,6H2,1H3 |
| InChIKey | RINCAIVZAWAFTF-UHFFFAOYSA-N |
| Density | 1.721g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.842°C at 760 mmHg (Cal.) |
| Flash point | 195.617°C (Cal.) |
| Refractive index | 1.674 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Bromophenyl)-4-methyl-2,5-dihydro-1,2,3-thiadiazole 1,1-dioxide |