|
CAS#: 951771-28-1 Product: 1,1'-[(4-Bromophenyl)methylene]bis(5-bromo-2-methoxybenzene) No suppilers available for the product. |
| Name | 1,1'-[(4-Bromophenyl)methylene]bis(5-bromo-2-methoxybenzene) |
|---|---|
| Synonyms | 4-bromo-2 |
| Molecular Formula | C21H17Br3O2 |
| Molecular Weight | 541.07 |
| CAS Registry Number | 951771-28-1 |
| SMILES | COc1ccc(cc1C(c2ccc(cc2)Br)c3cc(ccc3OC)Br)Br |
| InChI | 1S/C21H17Br3O2/c1-25-19-9-7-15(23)11-17(19)21(13-3-5-14(22)6-4-13)18-12-16(24)8-10-20(18)26-2/h3-12,21H,1-2H3 |
| InChIKey | ILSVCHWZQGLOQI-UHFFFAOYSA-N |
| Density | 1.643g/cm3 (Cal.) |
|---|---|
| Boiling point | 572.906°C at 760 mmHg (Cal.) |
| Flash point | 241.659°C (Cal.) |
| Refractive index | 1.625 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[(4-Bromophenyl)methylene]bis(5-bromo-2-methoxybenzene) |