|
CAS#: 951771-27-0 Product: 1,1'-[(2-Bromophenyl)methylene]bis(5-chloro-2-methoxybenzene) No suppilers available for the product. |
| Name | 1,1'-[(2-Bromophenyl)methylene]bis(5-chloro-2-methoxybenzene) |
|---|---|
| Synonyms | 2-((2-bro |
| Molecular Formula | C21H17BrCl2O2 |
| Molecular Weight | 452.17 |
| CAS Registry Number | 951771-27-0 |
| SMILES | COc1ccc(cc1C(c2ccccc2Br)c3cc(ccc3OC)Cl)Cl |
| InChI | 1S/C21H17BrCl2O2/c1-25-19-9-7-13(23)11-16(19)21(15-5-3-4-6-18(15)22)17-12-14(24)8-10-20(17)26-2/h3-12,21H,1-2H3 |
| InChIKey | MDARWXOVZMLTIT-UHFFFAOYSA-N |
| Density | 1.41g/cm3 (Cal.) |
|---|---|
| Boiling point | 521.093°C at 760 mmHg (Cal.) |
| Flash point | 268.948°C (Cal.) |
| Refractive index | 1.607 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[(2-Bromophenyl)methylene]bis(5-chloro-2-methoxybenzene) |