|
CAS#: 915402-16-3 Product: 1,1-(Ethylenedithio)-Indane-5-Boronic Acid No suppilers available for the product. |
| Name | 1,1-(Ethylenedithio)-Indane-5-Boronic Acid |
|---|---|
| Synonyms | Fs010912 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13BO2S2 |
| Molecular Weight | 252.15 |
| CAS Registry Number | 915402-16-3 |
| SMILES | C1=C3C(=CC=C1B(O)O)C2(SCCS2)CC3 |
| InChI | 1S/C11H13BO2S2/c13-12(14)9-1-2-10-8(7-9)3-4-11(10)15-5-6-16-11/h1-2,7,13-14H,3-6H2 |
| InChIKey | JVWLFCWJEYPPSC-UHFFFAOYSA-N |
| Density | 1.406g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.584°C at 760 mmHg (Cal.) |
| Flash point | 241.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-(Ethylenedithio)-Indane-5-Boronic Acid |