|
CAS#: 921938-61-6 Product: Pentafluorophenyl 3-(2-pyridinyloxy)benzoate No suppilers available for the product. |
| Name | Pentafluorophenyl 3-(2-pyridinyloxy)benzoate |
|---|---|
| Synonyms | MFCD09064956; Pentafluorophenyl 3-(pyrid-2-yloxy)benzoate; Pentafluorophenyl 3-(pyridin-2-yloxy)benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H8F5NO3 |
| Molecular Weight | 381.25 |
| CAS Registry Number | 921938-61-6 |
| SMILES | Fc3c(F)c(F)c(F)c(F)c3OC(=O)c1cc(ccc1)Oc2ccccn2 |
| InChI | 1S/C18H8F5NO3/c19-12-13(20)15(22)17(16(23)14(12)21)27-18(25)9-4-3-5-10(8-9)26-11-6-1-2-7-24-11/h1-8H |
| InChIKey | LKCOLTBNDUOLEF-UHFFFAOYSA-N |
| Density | 1.479g/cm3 (Cal.) |
|---|---|
| Melting point | 60.5-61.5°C (Expl.) |
| Boiling point | 504.321°C at 760 mmHg (Cal.) |
| Flash point | 258.805°C (Cal.) |
| Refractive index | 1.552 (Cal.) |
| Safety Description | Harmful |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Pentafluorophenyl 3-(2-pyridinyloxy)benzoate |