| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 3-(Pentafluorophenyl)Propanoyl Chloride |
|---|---|
| Synonyms | 3-(2,3,4,5,6-pentafluorophenyl)propanoyl chloride; 3-(Pentafluorophenyl)propionyl chloride; 3-(Perfluorophenyl)propanoyl chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H4ClF5O |
| Molecular Weight | 258.57 |
| CAS Registry Number | 2063-40-3 |
| SMILES | C(CC(=O)Cl)c1c(c(c(c(c1F)F)F)F)F |
| InChI | 1S/C9H4ClF5O/c10-4(16)2-1-3-5(11)7(13)9(15)8(14)6(3)12/h1-2H2 |
| InChIKey | ZREZSROHRNKDMF-UHFFFAOYSA-N |
| Density | 1.536g/cm3 (Cal.) |
|---|---|
| Melting point | 134.5-135°C (Expl.) |
| Boiling point | 228.682°C at 760 mmHg (Cal.) |
| Flash point | 92°C (Expl.) |
| 92.104°C (Cal.) | |
| Refractive index | 1.451 (Cal.) |
| Safety Description | Irritant |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(Pentafluorophenyl)Propanoyl Chloride |