Online Database of Chemicals from Around the World
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
 |
+49 2330-8079751 | |||
 |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Name | 3-(Pentafluorophenyl)-1-Propanol |
|---|---|
| Synonyms | 3-(2,3,4,5,6-pentafluorophenyl)propan-1-ol; 3-(pentafluorophenyl)propan-1-ol; 3-Pentafluorophenyl-propan-1-ol |
| Molecular Structure |  |
| Molecular Formula | C9H7F5O |
| Molecular Weight | 226.14 |
| CAS Registry Number | 1988-55-2 |
| SMILES | Fc1c(CCCO)c(F)c(F)c(F)c1F |
| InChI | 1S/C9H7F5O/c10-5-4(2-1-3-15)6(11)8(13)9(14)7(5)12/h15H,1-3H2 |
| InChIKey | OHLNWTOENDVTRM-UHFFFAOYSA-N |
| Density | 1.438g/cm3 (Cal.) |
|---|---|
| Boiling point | 219.245°C at 760 mmHg (Cal.) |
| Flash point | 86.397°C (Cal.) |
| Refractive index | 1.445 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Pentafluorophenyl)-1-Propanol |