Online Database of Chemicals from Around the World
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (386) 462-0788 | |||
 |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
|
+44 (845) 299-6009/ | |||
|
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Pentafluorophenyl 6-phenylnicotinate |
|---|---|
| Synonyms | MFCD09702345; Pentafluorophenyl 2-phenylpyridine-5-carboxylate; Pentafluorophenyl 6-phenylnicotinate |
| Molecular Structure |  |
| Molecular Formula | C18H8F5NO2 |
| Molecular Weight | 365.25 |
| CAS Registry Number | 934570-41-9 |
| SMILES | c1ccc(cc1)c2ccc(cn2)C(=O)Oc3c(c(c(c(c3F)F)F)F)F |
| InChI | 1S/C18H8F5NO2/c19-12-13(20)15(22)17(16(23)14(12)21)26-18(25)10-6-7-11(24-8-10)9-4-2-1-3-5-9/h1-8H |
| InChIKey | YUPUNKGUYBKZST-UHFFFAOYSA-N |
| Density | 1.447g/cm3 (Cal.) |
|---|---|
| Melting point | 113-115°C (Expl.) |
| Boiling point | 500.645°C at 760 mmHg (Cal.) |
| Flash point | 256.581°C (Cal.) |
| Refractive index | 1.551 (Cal.) |
| Safety Description | Harmful |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Pentafluorophenyl 6-phenylnicotinate |