| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Chemodex Ltd. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 244-4825 | |||
![]() |
info@chemodex.com | |||
| Chemical distributor | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Synchem OHG | Germany | |||
|---|---|---|---|---|
![]() |
+49 (5662) 40873-0 | |||
![]() |
info@synchem.de | |||
| Chemical manufacturer | ||||
| Name | 7-Diethylamino-N-[2-(2,5-Dioxopyrrol-1-Yl)Ethyl]-2-Oxochromene-3-Carboxamide |
|---|---|
| Synonyms | 7-Diethylamino-N-[2-(2,5-Dioxopyrrol-1-Yl)Ethyl]-2-Oxo-Chromene-3-Carboxamide; 7-Diethylamino-N-[2-(2,5-Dioxo-1-Pyrrolyl)Ethyl]-2-Oxo-3-Chromenecarboxamide; 7-Diethylamino-2-Keto-N-(2-Maleimidoethyl)Chromene-3-Carboxamide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 |
| CAS Registry Number | 156571-46-9 |
| SMILES | C2=C1OC(=O)C(=CC1=CC=C2N(CC)CC)C(=O)NCCN3C(=O)C=CC3=O |
| InChI | 1S/C20H21N3O5/c1-3-22(4-2)14-6-5-13-11-15(20(27)28-16(13)12-14)19(26)21-9-10-23-17(24)7-8-18(23)25/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,21,26) |
| InChIKey | IXQPRUQVJIJUEB-UHFFFAOYSA-N |
| Density | 1.346g/cm3 (Cal.) |
|---|---|
| Boiling point | 690.54°C at 760 mmHg (Cal.) |
| Flash point | 371.425°C (Cal.) |
| solubility | DMSO, DMF, Chloroform |
| SDS | Available |
|---|---|
| (1) | Jeremiah W. Hanes, Debashree Chatterjee, Erika V. Soriano, Steven E. Ealick and Tadhg P. Begley. Construction of a thiamin sensor from the periplasmic thiamin binding protein, Chem. Commun., 2011, 47, 2273. |
|---|---|
| Market Analysis Reports |