|
CAS#: 13177-32-7 Product: 8-Nitrofluoranthene No suppilers available for the product. |
| Name | 8-Nitrofluoranthene |
|---|---|
| Synonyms | Brn 2532952; Ccris 5507; Fluoranthene, 8-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H9NO2 |
| Molecular Weight | 247.25 |
| CAS Registry Number | 13177-32-7 |
| SMILES | C2=C3C1=C(C=CC=C1C=C2)C4=CC=C(C=C34)[N+]([O-])=O |
| InChI | 1S/C16H9NO2/c18-17(19)11-7-8-12-13-5-1-3-10-4-2-6-14(16(10)13)15(12)9-11/h1-9H |
| InChIKey | CTBYAQPHRFINGO-UHFFFAOYSA-N |
| Density | 1.422g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.744°C at 760 mmHg (Cal.) |
| Flash point | 230.322°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Nitrofluoranthene |