| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2,4,6-tri(phenyl)phosphinine |
|---|---|
| Synonyms | 2,4,6-Triphenylphosphinine; 2,4,6-Triphenylphosphorin; Nsc160481 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H17P |
| Molecular Weight | 324.36 |
| CAS Registry Number | 13497-36-4 |
| SMILES | P2=C(C=C(C1=CC=CC=C1)C=C2C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C23H17P/c1-4-10-18(11-5-1)21-16-22(19-12-6-2-7-13-19)24-23(17-21)20-14-8-3-9-15-20/h1-17H |
| InChIKey | SPVWSVYJPGRPFL-UHFFFAOYSA-N |
| (1) | Leen E. E. Broeckx, Martin Lutz, Dieter Vogt and Christian Müller. C–H activation of 2,4,6-triphenylphosphinine: unprecedented formation of cyclometalated [(P⁁C)Ir(iii)] and [(P⁁C)Rh(iii)] complexes, Chem. Commun., 2011, 47, 2003. |
|---|---|
| Market Analysis Reports |