|
CAS#: 13509-40-5 Product: N,N-Diphenylthiocarbamic Acid S-Phenyl Ester No suppilers available for the product. |
| Name | N,N-Diphenylthiocarbamic Acid S-Phenyl Ester |
|---|---|
| Synonyms | (Di(Phenyl)Amino)Methanethioic Acid S-Phenyl Ester; S-Phenyl Diphenylthiocarbamate; Carbamic Acid, Diphenylthio-, S-Phenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C19H15NOS |
| Molecular Weight | 305.39 |
| CAS Registry Number | 13509-40-5 |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=O)SC3=CC=CC=C3 |
| InChI | 1S/C19H15NOS/c21-19(22-18-14-8-3-9-15-18)20(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15H |
| InChIKey | UFYNNEYPWQBTRR-UHFFFAOYSA-N |
| Density | 1.251g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.254°C at 760 mmHg (Cal.) |
| Flash point | 227.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diphenylthiocarbamic Acid S-Phenyl Ester |