|
CAS#: 14512-84-6 Product: 3,5-Dinitrophenyl Phosphate No suppilers available for the product. |
| Name | 3,5-Dinitrophenyl Phosphate |
|---|---|
| Synonyms | 3,5-Dinitrophenyl Phosphate; 3,5-Dinitrophenylphosphate; Phenol, 3,5-Dinitro-, Dihydrogen Phosphate (Ester) |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5N2O8P |
| Molecular Weight | 264.09 |
| CAS Registry Number | 14512-84-6 |
| SMILES | C1=C(C=C(C=C1O[P](O)(O)=O)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C6H5N2O8P/c9-7(10)4-1-5(8(11)12)3-6(2-4)16-17(13,14)15/h1-3H,(H2,13,14,15) |
| InChIKey | FINQJAOKEWHFOX-UHFFFAOYSA-N |
| Density | 1.889g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.509°C at 760 mmHg (Cal.) |
| Flash point | 246.822°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dinitrophenyl Phosphate |