| Name | Benzo[b]Phenanthro[2,3-d]Thiophene |
|---|---|
| Synonyms | 9-Thianaphtho(1',2':2,3)Fluorene; Benzo(B)Phenanthro(2,3-D)Thiophene |
| Molecular Structure | ![]() |
| Molecular Formula | C20H12S |
| Molecular Weight | 284.37 |
| CAS Registry Number | 248-85-1 |
| SMILES | C1=CC=CC4=C1C3=CC2=CC=C5C(=C2C=C3S4)C=CC=C5 |
| InChI | 1S/C20H12S/c1-2-6-15-13(5-1)9-10-14-11-18-16-7-3-4-8-19(16)21-20(18)12-17(14)15/h1-12H |
| InChIKey | GDBRLJQTLSLZLH-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 523.215°C at 760 mmHg (Cal.) |
| Flash point | 205.129°C (Cal.) |
| (1) | Subodh Kumar. Synthesis of trans-3,4-dihydroxy-3,4-dihydrophenanthro[3,2-b?][1]benzothiophene, a potentially carcinogenic metabolite of sulfur heterocycle phenanthro[3,2-b?][1]benzothiophene, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 1018. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Benzo[b]Phenanthro[2,3-d]Thiophene |