| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Frinton Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (856) 722-7037 | |||
![]() |
frinton@frinton.com | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Szintekon Co, Ltd. | Hungary | |||
|---|---|---|---|---|
![]() |
info@szintekon.hu | |||
| Chemical manufacturer since 1996 | ||||
| Ukrorgsyntez Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+38 (044) 531-9497 | |||
![]() |
sales@uorsy.com | |||
| Chemical manufacturer since 2001 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | Naphthalen-1-Yl N-Methylcarbamate |
|---|---|
| Synonyms | 1-Naphthyl N-Methylcarbamate; N-Methylcarbamic Acid 1-Naphthyl Ester; Zinc00001090 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 |
| CAS Registry Number | 27636-33-5 |
| SMILES | C1=CC=CC2=CC=CC(=C12)OC(NC)=O |
| InChI | 1S/C12H11NO2/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3,(H,13,14) |
| InChIKey | CVXBEEMKQHEXEN-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 142°C (Expl.) |
| Boiling point | 315°C (Expl.) |
| 329.3±15.0°C at 760 mmHg (Cal.) | |
| Flash point | 202°C (Expl.) |
| 153.0±20.4°C (Cal.) | |
| solubility | 0.01% |
| Safety Description | Safety glasses, gloves, adequate ventilation. |
|---|---|
| (1) | Ashim K. Biswas, Napa Kondaiah, Anne Seeta Ram Anjaneyulu, Gadam Setty Rao and Ram Prakash Singh. A simple assay for analyzing residues of carbaryl insecticide in buffalo meat by liquid chromatography–photodiode array detection, Anal. Methods, 2010, 2, 393. |
|---|---|
| Market Analysis Reports |