|
CAS#: 60593-02-4 Product: 2-(Pentabromophenoxy)Ethanol No suppilers available for the product. |
| Name | 2-(Pentabromophenoxy)Ethanol |
|---|---|
| Synonyms | 2-(Pentabromophenoxy)Ethanol; Ethanol, 2-(Pentabromophenoxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Br5O2 |
| Molecular Weight | 532.65 |
| CAS Registry Number | 60593-02-4 |
| EINECS | 262-315-1 |
| SMILES | C(OC1=C(C(=C(Br)C(=C1Br)Br)Br)Br)CO |
| InChI | 1S/C8H5Br5O2/c9-3-4(10)6(12)8(15-2-1-14)7(13)5(3)11/h14H,1-2H2 |
| InChIKey | ZANXWPPILUXIGV-UHFFFAOYSA-N |
| Density | 2.556g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.051°C at 760 mmHg (Cal.) |
| Flash point | 233.845°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Pentabromophenoxy)Ethanol |