|
CAS#: 66291-34-7 Product: 4,9-Dimethylphenanthrene No suppilers available for the product. |
| Name | 4,9-Dimethylphenanthrene |
|---|---|
| Synonyms | Phenanthrene, 4,9-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 |
| CAS Registry Number | 66291-34-7 |
| SMILES | C2=CC1=C3C(=CC(=C1C=C2)C)C=CC=C3C |
| InChI | 1S/C16H14/c1-11-6-5-7-13-10-12(2)14-8-3-4-9-15(14)16(11)13/h3-10H,1-2H3 |
| InChIKey | INEVTIBHCBCQAP-UHFFFAOYSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.644°C at 760 mmHg (Cal.) |
| Flash point | 168.352°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,9-Dimethylphenanthrene |