|
CAS#: 6638-45-5 Product: 2-(3,4-Dimethoxy-Phenyl)-Benzothiazole No suppilers available for the product. |
| Name | 2-(3,4-Dimethoxy-Phenyl)-Benzothiazole |
|---|---|
| Synonyms | Nsc48229; Zinc01508712; 2-(3,4-Dimethoxyphenyl)Benzothiazole |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.33 |
| CAS Registry Number | 6638-45-5 |
| SMILES | C1=CC(=CC(=C1OC)OC)C3=NC2=C(C=CC=C2)S3 |
| InChI | 1S/C15H13NO2S/c1-17-12-8-7-10(9-13(12)18-2)15-16-11-5-3-4-6-14(11)19-15/h3-9H,1-2H3 |
| InChIKey | JMSHSEQKUVZWNO-UHFFFAOYSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.706°C at 760 mmHg (Cal.) |
| Flash point | 207.631°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3,4-Dimethoxy-Phenyl)-Benzothiazole |