| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 8-Hydroxyquinoline Benzoate |
|---|---|
| Synonyms | Benzoic Acid; 8-Quinolinol; 8-Quinolinol Benzoate (Salt); 8-Quinolinol Compd. With Benzoic Acid (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 |
| CAS Registry Number | 7091-57-8 |
| EINECS | 230-395-7 |
| SMILES | C1=CC=C(C2=NC=CC=C12)O.C3=C(C=CC=C3)C(O)=O |
| InChI | 1S/C9H7NO.C7H6O2/c11-8-5-1-3-7-4-2-6-10-9(7)8;8-7(9)6-4-2-1-3-5-6/h1-6,11H;1-5H,(H,8,9) |
| InChIKey | LYMABFPLCIQGMR-UHFFFAOYSA-N |
| Boiling point | 267°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 143.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Hydroxyquinoline Benzoate |