Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N2,6-Dimethyl-3H-purine-2,8-diamine |
|---|---|
| Synonyms | N2,6-dimethyl-7H-purine-2,8-diamine |
| Molecular Structure |  |
| Molecular Formula | C7H10N6 |
| Molecular Weight | 178.19 |
| CAS Registry Number | 802900-36-3 |
| SMILES | Cc1c2c(nc([nH]2)N)nc(n1)NC |
| InChI | 1S/C7H10N6/c1-3-4-5(12-6(8)11-4)13-7(9-2)10-3/h1-2H3,(H4,8,9,10,11,12,13) |
| InChIKey | UUWOEGREHHFZGZ-UHFFFAOYSA-N |
| Density | 1.49g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.168°C at 760 mmHg (Cal.) |
| Flash point | 245.406°C (Cal.) |
| Refractive index | 1.808 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N2,6-Dimethyl-3H-purine-2,8-diamine |