|
CAS#: 936250-25-8 Product: [2-(2,2-Difluoroethoxy)-3,5-difluorophenyl]boronic acid No suppilers available for the product. |
| Name | [2-(2,2-Difluoroethoxy)-3,5-difluorophenyl]boronic acid |
|---|---|
| Synonyms | 2-(2,2-Difluoro-ethoxy)-3,5-difluoro-benzeneboronic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7BF4O3 |
| Molecular Weight | 237.94 |
| CAS Registry Number | 936250-25-8 |
| SMILES | OB(O)c1cc(F)cc(F)c1OCC(F)F |
| InChI | 1S/C8H7BF4O3/c10-4-1-5(9(14)15)8(6(11)2-4)16-3-7(12)13/h1-2,7,14-15H,3H2 |
| InChIKey | VWDSCWROUYCJLL-UHFFFAOYSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.978°C at 760 mmHg (Cal.) |
| Flash point | 171.509°C (Cal.) |
| Refractive index | 1.45 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2-(2,2-Difluoroethoxy)-3,5-difluorophenyl]boronic acid |