Online Database of Chemicals from Around the World
|
CAS#: 131956-34-8 Product: 3,4,5-Trichloro-2-(2,3-Dichloropyrrol-1-Yl)Phenol No suppilers available for the product. |
| Name | 3,4,5-Trichloro-2-(2,3-Dichloropyrrol-1-Yl)Phenol |
|---|---|
| Synonyms | 3,4,5-Trichloro-2-(2,3-Dichloro-1-Pyrrolyl)Phenol; 2-(2,3-Dichloro-1H-Pyrrol-1-Yl)-3,4,5-Trichlorophenol; Neopyrrolomycin |
| Molecular Structure |  |
| Molecular Formula | C10H4Cl5NO |
| Molecular Weight | 331.41 |
| CAS Registry Number | 131956-34-8 |
| SMILES | C1=CC(=C(Cl)[N]1C2=C(O)C=C(Cl)C(=C2Cl)Cl)Cl |
| InChI | 1S/C10H4Cl5NO/c11-4-1-2-16(10(4)15)9-6(17)3-5(12)7(13)8(9)14/h1-3,17H |
| InChIKey | VQUHAXJBUPCVDX-UHFFFAOYSA-N |
| Density | 1.733g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.025°C at 760 mmHg (Cal.) |
| Flash point | 219.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,5-Trichloro-2-(2,3-Dichloropyrrol-1-Yl)Phenol |