Online Database of Chemicals from Around the World
|
CAS#: 53555-01-4 Product: 4,5,6-Trichloro-2-(2,4-dichlorophenoxy)phenol No suppilers available for the product. |
| Name | 4,5,6-Trichloro-2-(2,4-dichlorophenoxy)phenol |
|---|---|
| Synonyms | 2',3,4,4',5-Pentachloro-2-Hydroxydiphenyl Ether; 2-(2,4-Dichlorophenoxy)-4,5,6-Trichlorophenol; 4,5,6-Trichloro-2-(2,4-Dichlorophenoxy)Phenol |
| Molecular Structure |  |
| Molecular Formula | C12H5Cl5O2 |
| Molecular Weight | 358.44 |
| CAS Registry Number | 53555-01-4 |
| SMILES | C1=C(Cl)C=C(C(=C1)OC2=C(O)C(=C(Cl)C(=C2)Cl)Cl)Cl |
| InChI | 1S/C12H5Cl5O2/c13-5-1-2-8(6(14)3-5)19-9-4-7(15)10(16)11(17)12(9)18/h1-4,18H |
| InChIKey | PVLWIBDPWVHDIN-UHFFFAOYSA-N |
| Density | 1.643g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.348°C at 760 mmHg (Cal.) |
| Flash point | 186.247°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5,6-Trichloro-2-(2,4-dichlorophenoxy)phenol |